CAS 921939-04-0

N-methyl-1-(1-thieno[3,2-d]pyrimidin-4-yl-4-piperidyl)methanamine

Description:

N-methyl-1-(1-thieno[3,2-d]pyrimidin-4-yl-4-piperidyl)methanamine is a chemical compound characterized by its complex structure, which includes a thieno[3,2-d]pyrimidine moiety and a piperidine ring. This compound features a methyl group attached to a nitrogen atom, contributing to its classification as a tertiary amine. The thieno[3,2-d]pyrimidine component is known for its potential biological activity, often associated with various pharmacological properties. The presence of the piperidine ring enhances its ability to interact with biological targets, making it of interest in medicinal chemistry. The compound's molecular structure suggests it may exhibit properties such as lipophilicity, which can influence its absorption and distribution in biological systems. Additionally, the specific arrangement of functional groups may contribute to its selectivity and potency as a pharmacological agent. Overall, N-methyl-1-(1-thieno[3,2-d]pyrimidin-4-yl-4-piperidyl)methanamine represents a class of compounds that may have significant implications in drug development and therapeutic applications.

Formula: C₁₃H₁₈N₄S

InChI: InChI=1/C13H18N4S/c1-14-8-10-2-5-17(6-3-10)13-12-11(4-7-18-12)15-9-16-13/h4,7,9-10,14H,2-3,5-6,8H2,1H3

SMILES: CNCC1CCN(CC1)c1c2c(ccs2)ncn1

N-Methyl-1-[1-(thieno[3,2-d]pyrimidin-4-yl)piperidin-4-yl]methylamine

CAS: 921939-04-0

N-Methyl-1-[1-(thieno[3,2-d]pyrimidin-4-yl)piperidin-4-yl]methylamine

Purity: >90%

Color and Shape: Liquid

Molecular weight: 262.37g/mol

Ref: 54-OR12417