CAS 921939-13-1

[2-(2-thienyl)pyrimidin-5-yl]methanol

Description:

[2-(2-thienyl)pyrimidin-5-yl]methanol is a chemical compound characterized by its unique structural features, which include a pyrimidine ring substituted with a thienyl group and a hydroxymethyl group. The presence of the thienyl moiety introduces aromatic characteristics and potential for π-π interactions, while the hydroxymethyl group contributes to its reactivity and solubility in polar solvents. This compound may exhibit interesting biological activities due to its heterocyclic nature, making it a candidate for pharmaceutical research. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of novel therapeutic agents. Additionally, the compound's properties, such as melting point, solubility, and stability, would be influenced by the interactions between the thienyl and pyrimidine components, as well as the hydroxymethyl group. Overall, [2-(2-thienyl)pyrimidin-5-yl]methanol represents a versatile scaffold for further chemical modifications and investigations in various fields, including organic synthesis and drug discovery.

Formula: C₉H₈N₂OS

InChI: InChI=1/C9H8N2OS/c12-6-7-4-10-9(11-5-7)8-2-1-3-13-8/h1-5,12H,6H2

SMILES: c1cc(c2ncc(cn2)CO)sc1

[2-(Thien-2-yl)pyrimidin-5-yl]methanol

CAS: 921939-13-1

[2-(Thien-2-yl)pyrimidin-5-yl]methanol

Formula: C₉H₈N₂OS

Purity: 97%

Color and Shape: light orange crystalline powder

Molecular weight: 192.24g/mol

Ref: 54-OR14895