CAS 922-62-3
:cis-3-Methyl-2-pentene
Description:
Cis-3-Methyl-2-pentene is an organic compound classified as an alkene, characterized by its double bond between the second and third carbon atoms in the carbon chain. Its molecular formula is C6H12, indicating it consists of six carbon atoms and twelve hydrogen atoms. The "cis" designation refers to the spatial arrangement of the substituents around the double bond, where the methyl group and the hydrogen atom on the third carbon are on the same side, leading to a specific geometric configuration that influences its physical and chemical properties. This compound is a colorless liquid at room temperature and has a characteristic odor. It is less dense than water and is insoluble in water but soluble in organic solvents. Cis-3-Methyl-2-pentene can participate in various chemical reactions typical of alkenes, such as addition reactions, making it useful in organic synthesis and industrial applications. Its reactivity and properties can be influenced by the presence of the double bond and the methyl substituent, which can affect steric and electronic factors in chemical reactions.
Formula:C6H12
InChI:InChI=1S/C6H12/c1-4-6(3)5-2/h4H,5H2,1-3H3/b6-4-
InChI key:InChIKey=BEQGRRJLJLVQAQ-XQRVVYSFSA-N
SMILES:C(\CC)(=C\C)/C
Synonyms:- (2Z)-3-Methyl-2-pentene
- (Z)-3-Methyl-2-pentene
- (Z)-3-Methylpent-2-ene
- 2-Pentene, 3-methyl-, (2Z)-
- 2-Pentene, 3-methyl-, (Z)-
- 2-Pentene, 3-methyl-, (Z)- (8CI)(9CI)
- Nsc 73911
- cis-3-Methyl-2-pentene
- cis-3-Methyl-2-pentene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
