CAS 92202-51-2
:3-(9,10-ethanoanthracen-9(10H)-yl)propan-1-amine hydrochloride (1:1)
Description:
3-(9,10-ethanoanthracen-9(10H)-yl)propan-1-amine hydrochloride is a chemical compound characterized by its unique structure, which includes an ethanoanthracene moiety linked to a propan-1-amine group. This compound typically appears as a hydrochloride salt, indicating that it is a protonated amine, which enhances its solubility in water and polar solvents. The presence of the ethanoanthracene structure suggests potential applications in organic electronics or as a fluorescent probe due to its aromatic characteristics. The compound's molecular framework may also impart interesting photophysical properties, making it suitable for research in materials science or medicinal chemistry. As a hydrochloride salt, it is generally more stable and easier to handle than its free base form. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices. Overall, this compound represents a fascinating intersection of organic chemistry and potential applications in various fields.
Formula:C19H22ClN
InChI:InChI=1/C19H21N.ClH/c20-13-5-11-19-12-10-14(15-6-1-3-8-17(15)19)16-7-2-4-9-18(16)19;/h1-4,6-9,14H,5,10-13,20H2;1H
SMILES:c1ccc2c(c1)C1CCC2(CCCN)c2ccccc12.Cl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Maprotiline EP Impurity C HCl (N-Desmethyl Maprotiline HCl)
CAS:Formula:C19H21N·HClColor and Shape:White To Off-White SolidMolecular weight:263.38 36.46Maprotiline EP Impurity C-d4 HCl (N-Desmethyl Maprotiline-d4 HCl)
CAS:Formula:C19H17D4N·HClMolecular weight:267.41 36.46Desmethylmaprotiline Hydrochloride
CAS:Controlled ProductFormula:C19H21N·ClHColor and Shape:White SolidMolecular weight:299.84Desmethylmaprotiline hydrochloride
CAS:Desmethylmaprotiline hydrochloride is a drug product that is used in the manufacture of other drugs. It is an impurity standard for analytical purposes and an API impurity for pharmacopoeia. Desmethylmaprotiline hydrochloride is also a metabolite of maprotiline, which is used in the treatment of depression. The chemical structure of Desmethylmaprotiline hydrochloride can be found under CAS No. 92202-51-2 and it has been shown to be synthesized from maprotiline.
Formula:C19H22ClNPurity:Min. 95%Molecular weight:299.8 g/mol



