CymitQuimica logo

CAS 92206-72-9

:

bromo-[(4-bromophenyl)methyl]magnesium

Description:
Bromo-[(4-bromophenyl)methyl]magnesium, with the CAS number 92206-72-9, is an organomagnesium compound that belongs to the class of Grignard reagents. These compounds are characterized by the presence of a carbon-magnesium bond, which is highly reactive and plays a crucial role in organic synthesis. This specific compound features a bromo group and a phenyl ring substituted with a bromine atom, contributing to its reactivity and potential applications in nucleophilic addition reactions. Grignard reagents like this one are typically used to form carbon-carbon bonds, enabling the synthesis of alcohols, ketones, and other complex organic molecules. The presence of the bromine substituents can influence the reactivity and selectivity of the compound in various reactions. Additionally, due to the highly reactive nature of Grignard reagents, they must be handled under anhydrous conditions to prevent decomposition or unwanted side reactions with moisture. Overall, bromo-[(4-bromophenyl)methyl]magnesium is a valuable reagent in synthetic organic chemistry.
Formula:C7H6Br2Mg
InChI:InChI=1/C7H6Br.BrH.Mg/c1-6-2-4-7(8)5-3-6;;/h2-5H,1H2;1H;/q;;+1/p-1/rC7H6Br2Mg/c8-7-3-1-6(2-4-7)5-10-9/h1-4H,5H2
SMILES:C=C1C=CC(C=C1)Br.Br.[Mg]
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.