CymitQuimica logo

CAS 92210-61-2

:

6-methoxy-3-nitro-2H-chromene

Description:
6-Methoxy-3-nitro-2H-chromene is an organic compound belonging to the chromene class, characterized by its fused benzene and pyran rings. This compound features a methoxy group (-OCH3) at the 6-position and a nitro group (-NO2) at the 3-position, which contribute to its chemical reactivity and potential biological activity. The presence of the methoxy group enhances its lipophilicity, potentially influencing its solubility and interaction with biological membranes. The nitro group can participate in various chemical reactions, including reduction to amines, which may be relevant in medicinal chemistry. 6-Methoxy-3-nitro-2H-chromene may exhibit fluorescence properties, making it useful in analytical applications. Its structural features suggest potential applications in pharmaceuticals, particularly in the development of compounds with anti-inflammatory or anticancer properties. However, specific biological activities and toxicity profiles would require further investigation through experimental studies. Overall, this compound exemplifies the diverse chemistry of chromenes and their derivatives in organic synthesis and medicinal chemistry.
Formula:C10H9NO4
InChI:InChI=1/C10H9NO4/c1-14-9-2-3-10-7(5-9)4-8(6-15-10)11(12)13/h2-5H,6H2,1H3
SMILES:COc1ccc2c(C=C(CO2)N(=O)=O)c1
Synonyms:
  • 2H-1-benzopyran, 6-methoxy-3-nitro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.