CAS 922139-31-9

Recilisib sodium

Description:

Recilisib sodium, identified by its CAS number 922139-31-9, is a chemical compound that has garnered attention for its potential therapeutic applications, particularly in the context of viral infections. It is a sodium salt derivative of a specific active pharmaceutical ingredient, which suggests that it may exhibit enhanced solubility and bioavailability compared to its parent compound. The substance is characterized by its ability to inhibit certain viral replication processes, making it a candidate for antiviral drug development. In terms of its physical properties, Recilisib sodium is typically presented as a white to off-white powder, which is soluble in water, facilitating its use in various formulations. Its mechanism of action involves targeting specific viral enzymes or pathways, thereby disrupting the lifecycle of the virus. As with many pharmaceutical compounds, safety and efficacy are paramount, and ongoing research is essential to fully understand its pharmacokinetics, potential side effects, and therapeutic window.

Formula: C₁₆H₁₃ClO₄S·Na

InChI: InChI=1S/C16H13ClO4S.Na/c17-15-7-3-13(4-8-15)11-22(20,21)10-9-12-1-5-14(6-2-12)16(18)19;/h1-10H,11H2,(H,18,19);/b10-9+;

InChI key: InChIKey=NNNJPDWCCZUPQL-RRABGKBLSA-N

SMILES: C(=C/S(CC1=CC=C(Cl)C=C1)(=O)=O)\C2=CC=C(C(O)=O)C=C2.[Na]

Synonyms:

• Ex-Rad
• Recilisib sodium
• ON 01210.Na
• Benzoic acid, 4-[(1E)-2-[[(4-chlorophenyl)methyl]sulfonyl]ethenyl]-, sodium salt (1:1)
• Sodium 4-[(1E)-2-[[(4-chlorophenyl)methyl]sulfonyl]ethenyl]benzoate (1:1)

Recilisib sodium

CAS: 922139-31-9

Recilisib (ON 01210.Na) is a radioprotective agent altering cancer cell cycles and preventing radiation-induced apoptosis.

Formula: C₁₆H₁₃ClNaO₄S

Color and Shape: Solid

Molecular weight: 359.78

Ref: TM-T13862L

Recilisib sodium

CAS: 922139-31-9

Recilisib sodium is a synthetic compound, which is a stabilized sodium salt of a novel chemical entity developed through chemical synthesis. Its mode of action involves the modulation of cellular signaling pathways related to the DNA damage response. By enhancing the repair of radiation-induced DNA damage and mitigating apoptosis, it assists in maintaining genomic integrity under stress conditions.

Formula: C₁₆H₁₂ClNaO₄S

Purity: Min. 95%

Molecular weight: 358.8 g/mol

Ref: 3D-XLB13931