CymitQuimica logo

CAS 922162-66-1

:

N-(4-chloro-2-ethoxy-phenyl)-2,2-dimethyl-propanamide

Description:
N-(4-chloro-2-ethoxy-phenyl)-2,2-dimethyl-propanamide is a chemical compound characterized by its amide functional group, which is formed by the reaction of a carboxylic acid and an amine. This compound features a chloro-substituted aromatic ring, contributing to its potential biological activity and reactivity. The ethoxy group enhances its solubility in organic solvents, while the dimethyl-propanamide structure provides steric hindrance, which may influence its interaction with biological targets. The presence of chlorine in the aromatic ring can also affect the compound's electronic properties, potentially enhancing its lipophilicity and altering its pharmacokinetic profile. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its unique structural features that could lead to specific biological activities. As with many organic compounds, its stability, reactivity, and potential applications would depend on the specific conditions under which it is used, including temperature, pH, and the presence of other reactive species.
Formula:C13H18ClNO2
InChI:InChI=1/C13H18ClNO2/c1-5-17-11-8-9(14)6-7-10(11)15-12(16)13(2,3)4/h6-8H,5H2,1-4H3,(H,15,16)
SMILES:CCOc1cc(ccc1N=C(C(C)(C)C)O)Cl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.