CAS 92231-41-9

6-{[(5-chloro-2-methylphenyl)amino]methylidene}cyclohexa-2,4-dien-1-one

Description:

The chemical substance known as 6-{[(5-chloro-2-methylphenyl)amino]methylidene}cyclohexa-2,4-dien-1-one, with the CAS number 92231-41-9, is characterized by its complex molecular structure, which includes a cyclohexadiene core and an amino group substituted with a chloro-methylphenyl moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and stability. The presence of the chloro group may influence its electronic properties, making it a candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the compound may display biological activity, which could be of interest in pharmaceutical research. Its solubility, melting point, and other physical properties would depend on the specific conditions and solvents used. Overall, this compound's unique structure suggests potential applications in organic synthesis and medicinal chemistry, warranting further investigation into its reactivity and biological effects.

Formula: C₁₄H₁₂ClNO

InChI: InChI=1/C14H12ClNO/c1-10-6-7-12(15)8-13(10)16-9-11-4-2-3-5-14(11)17/h2-9,16H,1H3

SMILES: Cc1ccc(cc1NC=C1C=CC=CC1=O)Cl