CymitQuimica logo

CAS 92243-56-6

:

3-Phenylcyclobutanol

Description:
3-Phenylcyclobutanol is an organic compound characterized by its cyclobutane ring structure substituted with a phenyl group and a hydroxyl group. This compound features a four-membered carbon ring, which contributes to its unique strain and reactivity compared to larger cyclic compounds. The presence of the hydroxyl (-OH) group makes it an alcohol, influencing its solubility and reactivity in various chemical reactions. The phenyl group enhances its aromatic characteristics, potentially affecting its stability and interactions with other molecules. 3-Phenylcyclobutanol can participate in various chemical reactions, including oxidation and substitution, making it of interest in synthetic organic chemistry. Its structural features may also impart specific physical properties, such as boiling and melting points, which are influenced by intermolecular forces like hydrogen bonding due to the hydroxyl group. Overall, 3-Phenylcyclobutanol serves as a valuable compound in research and applications related to organic synthesis and materials science.
Formula:C10H12O
InChI:InChI=1S/C10H12O/c11-10-6-9(7-10)8-4-2-1-3-5-8/h1-5,9-11H,6-7H2
InChI key:InChIKey=BLLLZEOPEKUXEG-UHFFFAOYSA-N
SMILES:OC1CC(C1)C2=CC=CC=C2
Synonyms:
  • Cyclobutanol, 3-phenyl-
  • 3-Phenylcyclobutanol
  • 3-Phenylcyclobutan-1-ol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.