CAS 92243-76-0

1-(2-Bromo-1-methylethyl)-3-methylbenzene

Description:

1-(2-Bromo-1-methylethyl)-3-methylbenzene, also known as a substituted aromatic compound, features a bromine atom attached to a branched alkyl group on a methyl-substituted benzene ring. This compound is characterized by its hydrophobic nature due to the presence of the aromatic ring and the branched alkyl chain, which influences its solubility in organic solvents rather than water. The bromine substituent can impart unique reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. The presence of multiple methyl groups on the benzene ring contributes to steric hindrance, which can affect the compound's reactivity and interaction with other molecules. Additionally, the compound's molecular structure suggests it may exhibit interesting physical properties, such as boiling and melting points that differ from those of simpler hydrocarbons. Overall, this compound's characteristics make it relevant in organic synthesis and materials science, particularly in the development of pharmaceuticals and agrochemicals.

Formula: C₁₀H₁₃Br

InChI: InChI=1S/C10H13Br/c1-8-4-3-5-10(6-8)9(2)7-11/h3-6,9H,7H2,1-2H3

InChI key: InChIKey=SIBHYTRSEJERRY-UHFFFAOYSA-N

SMILES: C(CBr)(C)C1=CC(C)=CC=C1

Synonyms:

• 1-(1-Bromopropan-2-yl)-3-methylbenzene
• Benzene, 1-(2-bromo-1-methylethyl)-3-methyl-
• m-Cymene, 9-bromo-
• 1-(2-Bromo-1-methylethyl)-3-methylbenzene