CAS 922510-18-7

1,3,4,5,6,7,8,9,9-nonadeuteriofluoren-2-ol

Description:

1,3,4,5,6,7,8,9,9-nonadeuteriofluoren-2-ol is a deuterated derivative of fluoren-2-ol, which is a polycyclic aromatic compound featuring a hydroxyl group (-OH) attached to the fluorene structure. The presence of nine deuterium atoms indicates that hydrogen atoms in the molecule have been replaced with deuterium, a stable isotope of hydrogen, which can be useful in various analytical techniques, including NMR spectroscopy. This compound is characterized by its aromaticity, which contributes to its stability and unique chemical properties. The hydroxyl group introduces polarity, allowing for potential hydrogen bonding and influencing solubility in different solvents. The deuteration enhances the compound's utility in tracing studies and mechanistic investigations in organic chemistry. Additionally, the specific arrangement of substituents on the fluorene core can affect its reactivity and interaction with other chemical species. Overall, 1,3,4,5,6,7,8,9,9-nonadeuteriofluoren-2-ol serves as a valuable compound in research and applications involving isotopic labeling and structural analysis.

Formula: C₁₃HD₉O

InChI: InChI=1/C13H10O/c14-11-5-6-13-10(8-11)7-9-3-1-2-4-12(9)13/h1-6,8,14H,7H2/i1D,2D,3D,4D,5D,6D,7D2,8D

SMILES: c1(c(c(c2c(c1[2H])C(c1c(c(c(c(c21)[2H])[2H])O)[2H])([2H])[2H])[2H])[2H])[2H]

2-Hydroxy Fluorene-d9

Controlled Product

CAS: 922510-18-7

Applications A labelled metabolite of polycyclic aromatic hydrocarbons in humans.
References Jacob, J., et al.: Xenobiotica, 12, 45 (1982), Becher, G., et al.: Cancer Lett., 17, 301 (1983), Hoffmann, D., et al.: Cancer Treat. Res., 72, 1 (1995), Einolf, H., et al.: Chem. Res. Toxicol., 10, 609 (1997),

Formula: C₁₃HD₉O

Color and Shape: White To Off-White

Molecular weight: 191.27

Ref: TR-H942432