CAS 922510-20-1

1,2,4,5,6,7,8,9,10-nonadeuteriophenanthren-3-ol

Description:

1,2,4,5,6,7,8,9,10-nonadeuteriophenanthren-3-ol is a polycyclic aromatic compound characterized by its complex structure, which includes three fused benzene rings and a hydroxyl (-OH) group. The presence of nine deuterium atoms, which are isotopes of hydrogen, indicates that this compound is a labeled version of phenanthren-3-ol, often used in research to trace chemical pathways or study reaction mechanisms. The hydroxyl group contributes to its solubility in polar solvents and can influence its reactivity, making it a potential candidate for various chemical reactions, including oxidation and substitution. This compound may exhibit unique physical properties, such as altered melting and boiling points compared to its non-deuterated counterpart, due to the mass difference introduced by deuterium. Additionally, its spectral characteristics, such as NMR and IR, would be distinct, allowing for precise identification and analysis in laboratory settings. Overall, 1,2,4,5,6,7,8,9,10-nonadeuteriophenanthren-3-ol serves as a valuable tool in organic chemistry and materials science.

Formula: C₁₄HD₉O

InChI: InChI=1/C14H10O/c15-12-8-7-11-6-5-10-3-1-2-4-13(10)14(11)9-12/h1-9,15H/i1D,2D,3D,4D,5D,6D,7D,8D,9D

SMILES: c1(c(c(c2c(c1[2H])c(c(c1c(c(c(c(c21)[2H])O)[2H])[2H])[2H])[2H])[2H])[2H])[2H]

3-Phenanthrol-d9 (Major)

Controlled Product

CAS: 922510-20-1

Applications A labelled metabolite of Phenanthrene.
References Boyland, E., et al.: Biochem. J., 84, 564 (1962), Hamada, S., et al.: Mutat. Res., 495, 127 (2001), Shimada, T., et al.: Drug Metab. Dispos., 29, 1176 (2001), Moennikes, O., et al.: Cancer Res., 64, 4707 (2004), Albig, A., et al.: Mol. Biol. Cell., 16, 609 (2005),

Formula: C₁₄₂H₉HO

Color and Shape: Neat

Molecular weight: 203.28

Ref: TR-P295012