CymitQuimica logo

CAS 922510-96-1

:

2,3,4,5-Tetrahydro-8-methoxy-6-(trifluoromethyl)-1H-pyrido[4,3-b]indole

Description:
2,3,4,5-Tetrahydro-8-methoxy-6-(trifluoromethyl)-1H-pyrido[4,3-b]indole is a chemical compound characterized by its complex bicyclic structure, which incorporates both pyridine and indole moieties. This compound features a tetrahydro configuration, indicating the presence of a saturated ring system, and includes a methoxy group (-OCH3) and a trifluoromethyl group (-CF3) that contribute to its unique chemical properties. The trifluoromethyl group is known for enhancing lipophilicity and metabolic stability, while the methoxy group can influence solubility and reactivity. The compound's structure suggests potential biological activity, making it of interest in medicinal chemistry and pharmacology. Its specific interactions and effects would depend on the context of its use, including potential applications in drug development or as a research tool. As with many complex organic compounds, its synthesis and characterization would require careful analytical techniques to confirm purity and structural integrity.
Formula:C13H13F3N2O
InChI:InChI=1S/C13H13F3N2O/c1-19-7-4-8-9-6-17-3-2-11(9)18-12(8)10(5-7)13(14,15)16/h4-5,17-18H,2-3,6H2,1H3
InChI key:InChIKey=OGLDPCGBFUZMJF-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=C2C(C3=C(N2)CCNC3)=CC(OC)=C1
Synonyms:
  • 8-Methoxy-6-(trifluoromethyl)-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole
  • 1H-Pyrido[4,3-b]indole, 2,3,4,5-tetrahydro-8-methoxy-6-(trifluoromethyl)-
  • 2,3,4,5-Tetrahydro-8-methoxy-6-(trifluoromethyl)-1H-pyrido[4,3-b]indole
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.