CymitQuimica logo

CAS 92254-27-8

:

4-methoxybiphenyl-2-carboxylic acid

Description:
4-Methoxybiphenyl-2-carboxylic acid, with the CAS number 92254-27-8, is an organic compound characterized by its biphenyl structure substituted with a methoxy group and a carboxylic acid functional group. This compound typically exhibits a white to off-white crystalline appearance. The presence of the methoxy group enhances its solubility in organic solvents, while the carboxylic acid group contributes to its acidic properties, allowing for potential interactions in various chemical reactions. It may participate in hydrogen bonding due to the carboxylic acid, influencing its reactivity and interactions with other molecules. The compound is of interest in various fields, including pharmaceuticals and materials science, due to its potential applications in synthesis and as a building block for more complex molecules. Additionally, its structural features may impart specific biological activities, making it a candidate for further research in medicinal chemistry. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C14H12O3
InChI:InChI=1/C14H12O3/c1-17-11-7-8-12(13(9-11)14(15)16)10-5-3-2-4-6-10/h2-9H,1H3,(H,15,16)
SMILES:COc1ccc(c2ccccc2)c(c1)C(=O)O
Synonyms:
  • [1,1'-Biphenyl]-2-Carboxylic Acid, 4-Methoxy-
  • 4-Methoxy-1,1'-Biphenyl-2-Carboxylic Acid
  • 4-Methoxybiphenyl-2-carboxylic acid
  • 5-Methoxy-2-phenylbenzoic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.