CAS 92254-28-9

Methyl 2′-hydroxy[1,1′-biphenyl]-3-carboxylate

Description:

Methyl 2′-hydroxy[1,1′-biphenyl]-3-carboxylate, identified by its CAS number 92254-28-9, is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features a carboxylate functional group (-COO-) and a hydroxyl group (-OH) attached to the biphenyl framework, contributing to its chemical reactivity and potential applications. The presence of the methyl ester group enhances its solubility in organic solvents, making it useful in various chemical reactions and syntheses. Methyl 2′-hydroxy[1,1′-biphenyl]-3-carboxylate may exhibit biological activity, which could be of interest in pharmaceutical research. Its structural characteristics suggest potential for hydrogen bonding due to the hydroxyl group, influencing its physical properties such as melting point and boiling point. Overall, this compound is significant in organic chemistry and may serve as a precursor or intermediate in the synthesis of more complex molecules.

Formula: C₁₄H₁₂O₃

InChI: InChI=1S/C14H12O3/c1-17-14(16)11-6-4-5-10(9-11)12-7-2-3-8-13(12)15/h2-9,15H,1H3

InChI key: InChIKey=BRGRVHYFRYIRLD-UHFFFAOYSA-N

SMILES: OC1=C(C2=CC(C(OC)=O)=CC=C2)C=CC=C1

Synonyms:

• Methyl 2′-hydroxy[1,1′-biphenyl]-3-carboxylate
• [1,1′-Biphenyl]-3-carboxylic acid, 2′-hydroxy-, methyl ester
• 3-Biphenylcarboxylic acid, 2′-hydroxy-, methyl ester

2-(3-Methoxycarbonylphenyl)phenol

CAS: 92254-28-9

Formula: C₁₄H₁₂O₃

Molecular weight: 228.2433

Ref: IN-DA006DM0