CymitQuimica logo

CAS 922552-57-6

:

6-Chloro-2,3,4,5-tetrahydro-9-(trifluoromethyl)-1H-pyrido[4,3-b]indole

Description:
6-Chloro-2,3,4,5-tetrahydro-9-(trifluoromethyl)-1H-pyrido[4,3-b]indole is a heterocyclic compound characterized by its complex bicyclic structure, which incorporates both pyridine and indole moieties. The presence of a chloro group and a trifluoromethyl group significantly influences its chemical properties, including its reactivity and lipophilicity. This compound is typically solid at room temperature and may exhibit moderate to high stability under standard conditions. Its unique structure suggests potential biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The trifluoromethyl group can enhance metabolic stability and bioavailability, while the chloro substituent may affect the compound's interaction with biological targets. Additionally, the compound's solubility and partitioning behavior can be influenced by its functional groups, which is crucial for its application in drug design. Overall, 6-Chloro-2,3,4,5-tetrahydro-9-(trifluoromethyl)-1H-pyrido[4,3-b]indole represents a valuable scaffold for further research and development in various chemical and biological fields.
Formula:C12H10ClF3N2
InChI:InChI=1S/C12H10ClF3N2/c13-8-2-1-7(12(14,15)16)10-6-5-17-4-3-9(6)18-11(8)10/h1-2,17-18H,3-5H2
InChI key:InChIKey=OPNSFUSUCUJPPZ-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=C2C3=C(NC2=C(Cl)C=C1)CCNC3
Synonyms:
  • 6-Chloro-2,3,4,5-tetrahydro-9-(trifluoromethyl)-1H-pyrido[4,3-b]indole
  • 1H-Pyrido[4,3-b]indole, 6-chloro-2,3,4,5-tetrahydro-9-(trifluoromethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.