CymitQuimica logo

CAS 92260-81-6

:

8,9-dihydro-2H,7H-2,9a-diaza-benzo[cd]azulene-1,6-dione

Description:
8,9-Dihydro-2H,7H-2,9a-diaza-benzo[cd]azulene-1,6-dione, with the CAS number 92260-81-6, is a heterocyclic organic compound characterized by its complex fused ring structure that incorporates nitrogen atoms within its framework. This compound features a bicyclic system that includes both azole and aromatic characteristics, contributing to its unique chemical properties. The presence of the dione functional groups indicates that it contains two carbonyl (C=O) groups, which can influence its reactivity and potential applications in organic synthesis or materials science. The nitrogen atoms in the structure can also impart basicity and influence the compound's interaction with other chemical species. Typically, compounds of this nature may exhibit interesting electronic properties, making them candidates for studies in photochemistry or as potential dyes. However, specific physical properties such as solubility, melting point, and spectral characteristics would need to be referenced from experimental data or literature for detailed applications and behavior in various environments.
Formula:C11H10N2O2
InChI:InChI=1S/C11H10N2O2/c14-9-5-2-6-13-10-7(9)3-1-4-8(10)12-11(13)15/h1,3-4H,2,5-6H2,(H,12,15)
InChI key:QDMYVAGJPVQRSQ-UHFFFAOYSA-N
SMILES:C1CC(=O)C2=C3C(=CC=C2)NC(=O)N3C1
Synonyms:
  • 5,6-Dihydroimidazo[4,5,1-jk][1]benzazepine-2,7(1H,4H)-dione
  • 5,6-Dihydro-Imidazo[4,5,1-Jk][1]Benzazepine-2,7(1H,4H)-Dione
  • 5,6-Dihydro-iMidazo[4,5,l-j-k][1]benzazepine-2,7-[1H,4H]-dione
Found 5 products.