CAS 92262-75-4
:naphtho[2,1-b]furan-1-ylacetate
Description:
Naphtho[2,1-b]furan-1-ylacetate is an organic compound characterized by its unique structure, which consists of a naphtho[2,1-b]furan moiety attached to an acetate group. This compound typically exhibits a fused ring system, contributing to its aromatic properties and potential for various chemical interactions. It is generally a solid at room temperature and may have moderate solubility in organic solvents, reflecting its hydrophobic nature due to the polycyclic aromatic structure. The presence of the acetate functional group can influence its reactivity, making it a potential candidate for various chemical reactions, including esterification and nucleophilic substitutions. Naphtho[2,1-b]furan-1-ylacetate may also exhibit interesting biological activities, which could be explored in medicinal chemistry. Its specific applications and behavior in chemical reactions can vary based on the conditions and the presence of other reagents. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks or environmental hazards.
Formula:C14H9O3
InChI:InChI=1/C14H10O3/c15-13(16)7-10-8-17-12-6-5-9-3-1-2-4-11(9)14(10)12/h1-6,8H,7H2,(H,15,16)/p-1
SMILES:c1ccc2c(c1)ccc1c2c(CC(=O)[O-])co1
Synonyms:- Naphtho[2,1-B]Furan-1-Acetic Acid, Ion(1-)
- Naphtho[2,1-b]furan-1-ylacetate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.