
CAS 92278-55-2
:4H-1,2,4-triazole-3,5-diamine sulfate (1:1)
Description:
4H-1,2,4-triazole-3,5-diamine sulfate (1:1), with the CAS number 92278-55-2, is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This substance typically appears as a crystalline solid and is soluble in water, which is a common trait for many sulfate salts. The presence of amino groups in its structure contributes to its potential reactivity and ability to form hydrogen bonds, influencing its solubility and interaction with other compounds. It is often studied for its applications in agriculture, particularly as a fungicide or plant growth regulator, due to its ability to affect plant metabolism. Additionally, the sulfate component indicates that it can dissociate in solution, releasing sulfate ions, which may have implications for its biological activity and environmental behavior. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C2H7N5O4S
InChI:InChI=1/C2H5N5.H2O4S/c3-1-5-2(4)7-6-1;1-5(2,3)4/h(H5,3,4,5,6,7);(H2,1,2,3,4)
SMILES:c1(=N)[nH]c(=N)[nH][nH]1.OS(=O)(=O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.

