CAS 92287-47-3

8-Methoxy-2-naphthalenamine

Description:

8-Methoxy-2-naphthalenamine, with the CAS number 92287-47-3, is an organic compound characterized by its naphthalene structure substituted with a methoxy group and an amino group. This compound typically exhibits a solid state at room temperature and is known for its aromatic properties due to the presence of the naphthalene ring. The methoxy group (-OCH3) enhances its solubility in organic solvents and can influence its reactivity and interaction with other chemical species. The amino group (-NH2) contributes to its basicity and potential for forming hydrogen bonds, making it a candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, 8-Methoxy-2-naphthalenamine may exhibit biological activity, which can be of interest in pharmaceutical research. Its properties, such as melting point, boiling point, and spectral characteristics, can vary based on purity and environmental conditions. Overall, this compound is significant in organic synthesis and may have applications in dye production, pharmaceuticals, and materials science.

Formula: C₁₁H₁₁NO

InChI: InChI=1S/C11H11NO/c1-13-11-4-2-3-8-5-6-9(12)7-10(8)11/h2-7H,12H2,1H3

InChI key: InChIKey=HPVYDSOJYTVLKV-UHFFFAOYSA-N

SMILES: O(C)C=1C2=C(C=CC(N)=C2)C=CC1

Synonyms:

• 2-Naphthalenamine, 8-methoxy-
• 8-Methoxy-2-naphthalenamine
• 2-Naphthylamine, 8-methoxy-