CAS 92289-38-8
:2-methyl-6-phenylpyrimidin-4-amine
Description:
2-Methyl-6-phenylpyrimidin-4-amine is an organic compound characterized by its pyrimidine ring structure, which is a six-membered aromatic heterocycle containing two nitrogen atoms at the 1 and 3 positions. This compound features a methyl group at the 2-position and a phenyl group at the 6-position, contributing to its unique chemical properties. The amine functional group at the 4-position enhances its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The presence of both the methyl and phenyl groups can influence the compound's solubility, stability, and interaction with biological systems. Typically, compounds of this nature may exhibit biological activity, making them of interest in medicinal chemistry and drug development. Additionally, the molecular structure can lead to specific interactions with enzymes or receptors, which may be explored in pharmacological studies. Overall, 2-methyl-6-phenylpyrimidin-4-amine represents a versatile scaffold in organic synthesis and medicinal chemistry.
Formula:C11H11N3
InChI:InChI=1/C11H11N3/c1-8-13-10(7-11(12)14-8)9-5-3-2-4-6-9/h2-7H,1H3,(H2,12,13,14)
SMILES:Cc1nc(cc(=N)[nH]1)c1ccccc1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.