CAS 92297-66-0
:2-methoxy-6-(propan-2-yl)naphthalene
Description:
2-Methoxy-6-(propan-2-yl)naphthalene, also known by its CAS number 92297-66-0, is an organic compound that belongs to the class of naphthalene derivatives. This substance features a naphthalene backbone substituted with a methoxy group (-OCH3) at the 2-position and an isopropyl group (-C(CH3)2) at the 6-position. The presence of these substituents influences its physical and chemical properties, such as solubility, boiling point, and reactivity. Typically, compounds of this nature exhibit hydrophobic characteristics due to the aromatic naphthalene structure, making them less soluble in water but more soluble in organic solvents. The methoxy group can participate in various chemical reactions, including electrophilic aromatic substitution, while the isopropyl group can affect steric hindrance and the overall reactivity of the molecule. Additionally, such compounds may have applications in organic synthesis, materials science, or as intermediates in the production of other chemical entities. Safety and handling precautions should be observed, as with all chemical substances.
Formula:C14H16O
InChI:InChI=1/C14H16O/c1-10(2)11-4-5-13-9-14(15-3)7-6-12(13)8-11/h4-10H,1-3H3
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.