
CAS 923-01-3
:β-Cyanoalanine
Description:
β-Cyanoalanine, with the CAS number 923-01-3, is a non-proteinogenic amino acid characterized by the presence of both a cyano group (-CN) and an amino group (-NH2) attached to a carbon chain. It is structurally related to alanine, differing primarily by the addition of the cyano group at the beta position. This compound is typically a white crystalline solid and is soluble in water, which facilitates its use in various biochemical applications. β-Cyanoalanine is known for its role as a precursor in the biosynthesis of certain amino acids and can act as a potent inhibitor of specific enzymes, making it of interest in biochemical research. Additionally, it has been studied for its potential applications in agriculture, particularly in relation to plant metabolism and stress responses. Its reactivity and functional groups allow it to participate in various chemical reactions, contributing to its utility in synthetic organic chemistry. Overall, β-Cyanoalanine is a versatile compound with significant implications in both biological and chemical contexts.
Formula:C4H6N2O2
InChI:InChI=1S/C4H6N2O2/c5-2-1-3(6)4(7)8/h3H,1,6H2,(H,7,8)
InChI key:InChIKey=BXRLWGXPSRYJDZ-UHFFFAOYSA-N
SMILES:C(CC#N)(C(O)=O)N
Synonyms:- 2-Amino-3-cyanopropanoic acid
- 3-Cyanoalanine
- Alanine, 3-cyano-
- β-Cyanoalanine
- NSC 529055
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.