CAS 92302-55-1

Devapamil

Description:

Devapamil is a chemical compound classified as a calcium channel blocker, primarily used in the treatment of hypertension and certain types of angina. It is known for its ability to inhibit the influx of calcium ions through voltage-gated calcium channels, which leads to relaxation of vascular smooth muscle and a subsequent decrease in blood pressure. Devapamil exhibits a relatively high lipophilicity, allowing it to cross cell membranes effectively. The compound has a unique chemical structure that contributes to its pharmacological properties, including a specific arrangement of functional groups that enhance its binding affinity to calcium channels. Additionally, Devapamil may exhibit some antiarrhythmic properties, making it useful in managing certain cardiac conditions. Its pharmacokinetics involve absorption, distribution, metabolism, and excretion, which can vary based on individual patient factors. As with any medication, potential side effects may include dizziness, headache, and gastrointestinal disturbances, necessitating careful monitoring during treatment. Overall, Devapamil represents a valuable therapeutic option in cardiovascular medicine.

Formula: C₂₆H₃₆N₂O₃

InChI: InChI=1S/C26H36N2O3/c1-20(2)26(19-27,22-11-12-24(30-5)25(18-22)31-6)14-8-15-28(3)16-13-21-9-7-10-23(17-21)29-4/h7,9-12,17-18,20H,8,13-16H2,1-6H3

InChI key: InChIKey=VMVKIDPOEOLUFS-UHFFFAOYSA-N

SMILES: C(CCCN(CCC1=CC(OC)=CC=C1)C)(C(C)C)(C#N)C2=CC(OC)=C(OC)C=C2

Synonyms:

• Devapamil
• (±)-Devapamil
• D 888
• 3,4-Dimethoxy-α-[3-[[2-(3-methoxyphenyl)ethyl]methylamino]propyl]-α-(1-methylethyl)benzeneacetonitrile
• Benzeneacetonitrile, 3,4-dimethoxy-α-[3-[[2-(3-methoxyphenyl)ethyl]methylamino]propyl]-α-(1-methylethyl)-

Devapamil

CAS: 92302-55-1

Devapamil (Devapamilo) is a phenylalkylamine that blocks L-type calcium currents from the inner side of membrane cells in a use-dependent manner.

Formula: C₂₆H₃₆N₂O₃

Purity: 99.63%

Color and Shape: Solid

Molecular weight: 424.58

Ref: TM-T68055

Devapamil

CAS: 92302-55-1

Devapamil

Purity: ≥98%

Molecular weight: 424.58g/mol

Ref: 54-BUP08143