CAS 923032-57-9

Cyclopropanesulfonic acid, 1-(2-propen-1-yl)-, potassium salt (1:1)

Description:

Cyclopropanesulfonic acid, 1-(2-propen-1-yl)-, potassium salt (1:1) is a chemical compound characterized by its unique structure, which includes a cyclopropane ring and a sulfonic acid functional group. The presence of the propenyl group contributes to its reactivity, making it a potential candidate for various chemical reactions, including polymerization and substitution reactions. As a potassium salt, it exhibits enhanced solubility in polar solvents, which can facilitate its use in various applications, such as in organic synthesis or as a reagent in chemical processes. The compound's sulfonic acid moiety imparts acidic properties, which can influence its behavior in different pH environments. Additionally, the cyclopropane structure may confer strain, affecting the stability and reactivity of the compound. Overall, this substance is of interest in both academic research and industrial applications due to its distinctive chemical properties and potential utility in synthesizing more complex molecules.

Formula: C₆H₁₀O₃S·K

InChI: InChI=1S/C6H10O3S.K/c1-2-3-6(4-5-6)10(7,8)9;/h2H,1,3-5H2,(H,7,8,9);

InChI key: InChIKey=IWAWSMYAQRRAHR-UHFFFAOYSA-N

SMILES: S(=O)(=O)(O)C1(CC=C)CC1.[K]

Synonyms:

• Cyclopropanesulfonic acid, 1-(2-propen-1-yl)-, potassium salt (1:1)