CAS 92309-62-1

1-benzyl-3-methyl-piperidin-4-amine dihydrochloride

Description:

1-Benzyl-3-methyl-piperidin-4-amine dihydrochloride is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. This compound features a benzyl group and a methyl group attached to the piperidine ring, specifically at the 1 and 3 positions, respectively, while the amine functional group is located at the 4 position. The dihydrochloride salt form indicates that the compound is protonated and stabilized by two hydrochloric acid molecules, enhancing its solubility in water. This substance may exhibit biological activity, potentially interacting with various receptors or enzymes due to its amine functionality. Its molecular structure suggests it could be of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The compound's properties, such as melting point, solubility, and stability, would be influenced by its specific molecular interactions and the presence of the dihydrochloride salt. As with many amines, it may also exhibit basicity, allowing it to participate in various chemical reactions.

Formula: C₁₃H₂₂Cl₂N₂

InChI: InChI=1/C13H20N2.2ClH/c1-11-9-15(8-7-13(11)14)10-12-5-3-2-4-6-12;;/h2-6,11,13H,7-10,14H2,1H3;2*1H

SMILES: CC1CN(CCC1N)Cc1ccccc1.Cl.Cl

Synonyms:

• 1-Benzyl-3-methylpiperidin-4-amine dihydrochloride