CymitQuimica logo

CAS 923105-86-6

:

2,3,4,5-Tetrahydro-2,4-dioxo-1H-1,5-benzodiazepine-7-sulfonamide

Description:
2,3,4,5-Tetrahydro-2,4-dioxo-1H-1,5-benzodiazepine-7-sulfonamide is a chemical compound characterized by its complex bicyclic structure, which includes a benzodiazepine core. This compound features a sulfonamide group, contributing to its potential biological activity. The presence of two carbonyl (dioxo) groups enhances its reactivity and may influence its interaction with biological targets. The tetrahydro configuration indicates that the compound is saturated, which can affect its solubility and stability. Typically, compounds of this nature are investigated for their pharmacological properties, including potential applications in medicinal chemistry, such as acting as inhibitors or modulators in various biological pathways. The specific arrangement of functional groups and the overall molecular geometry play crucial roles in determining the compound's activity, selectivity, and efficacy in biological systems. As with many benzodiazepine derivatives, it may exhibit properties related to anxiety modulation, though detailed studies would be necessary to elucidate its specific effects and mechanisms of action.
Formula:C9H9N3O4S
InChI:InChI=1S/C9H9N3O4S/c10-17(15,16)5-1-2-6-7(3-5)12-9(14)4-8(13)11-6/h1-3H,4H2,(H,11,13)(H,12,14)(H2,10,15,16)
InChI key:InChIKey=XPRIVEDODHGKTJ-UHFFFAOYSA-N
SMILES:S(N)(=O)(=O)C=1C=C2C(=CC1)NC(=O)CC(=O)N2
Synonyms:
  • 2,3,4,5-Tetrahydro-2,4-dioxo-1H-1,5-benzodiazepine-7-sulfonamide
  • 1H-1,5-Benzodiazepine-7-sulfonamide, 2,3,4,5-tetrahydro-2,4-dioxo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.