CAS 923106-39-2

1-[(Ethylamino)carbonyl]-3-piperidinecarboxylic acid

Description:

1-[(Ethylamino)carbonyl]-3-piperidinecarboxylic acid, identified by its CAS number 923106-39-2, is a chemical compound characterized by its piperidine ring structure, which is a six-membered nitrogen-containing heterocycle. This compound features an ethylamino group and a carboxylic acid functional group, contributing to its potential as a bioactive molecule. The presence of the ethylamino moiety suggests that it may exhibit basic properties, while the carboxylic acid group imparts acidity. The piperidine ring can influence the compound's solubility and reactivity, making it relevant in medicinal chemistry and drug design. Its structural characteristics may allow for interactions with biological targets, potentially leading to pharmacological effects. As with many compounds containing both amine and carboxylic acid functionalities, it may participate in various chemical reactions, including amide formation and esterification. Overall, this compound's unique structure positions it as a candidate for further investigation in pharmaceutical applications and synthetic chemistry.

Formula: C₉H₁₆N₂O₃

InChI: InChI=1S/C9H16N2O3/c1-2-10-9(14)11-5-3-4-7(6-11)8(12)13/h7H,2-6H2,1H3,(H,10,14)(H,12,13)

InChI key: InChIKey=LOXUBGHTPWVMKI-UHFFFAOYSA-N

SMILES: C(NCC)(=O)N1CC(C(O)=O)CCC1

Synonyms:

• 3-Piperidinecarboxylic acid, 1-[(ethylamino)carbonyl]-
• 1-[(Ethylamino)carbonyl]-3-piperidinecarboxylic acid