CAS 923125-45-5

1-[5-(Aminocarbonyl)-2-pyridinyl]-4-piperidinecarboxylic acid

Description:

1-[5-(Aminocarbonyl)-2-pyridinyl]-4-piperidinecarboxylic acid, with the CAS number 923125-45-5, is a chemical compound characterized by its complex structure, which includes a pyridine ring and a piperidine moiety. This compound features an aminocarbonyl group, which contributes to its potential as a bioactive molecule. It is typically a white to off-white solid and is soluble in polar solvents, reflecting its functional groups' ability to engage in hydrogen bonding. The presence of both the carboxylic acid and the aminocarbonyl groups suggests that it may exhibit acidic properties and could participate in various chemical reactions, including amide formation and esterification. This compound is of interest in medicinal chemistry, particularly for its potential applications in drug development, as it may interact with biological targets due to its structural features. Its stability, reactivity, and solubility characteristics make it a candidate for further research in pharmacology and related fields.

Formula: C₁₂H₁₅N₃O₃

InChI: InChI=1S/C12H15N3O3/c13-11(16)9-1-2-10(14-7-9)15-5-3-8(4-6-15)12(17)18/h1-2,7-8H,3-6H2,(H2,13,16)(H,17,18)

InChI key: InChIKey=WGGYGZHZMWRLOV-UHFFFAOYSA-N

SMILES: C(N)(=O)C1=CC=C(N=C1)N2CCC(C(O)=O)CC2

Synonyms:

• 5′-Carbamoyl-3,4,5,6-tetrahydro-2H-[1,2′]bipyridinyl-4-carboxylic acid
• 4-Piperidinecarboxylic acid, 1-[5-(aminocarbonyl)-2-pyridinyl]-
• 1-[5-(Aminocarbonyl)-2-pyridinyl]-4-piperidinecarboxylic acid
• 1-(5-Carbamoylpyridin-2-yl)piperidine-4-carboxylic acid

1-(5-Carbamoylpyridin-2-yl)piperidine-4-carboxylic acid

CAS: 923125-45-5

Versatile small molecule scaffold

Formula: C₁₂H₁₅N₃O₃

Purity: Min. 95%

Molecular weight: 249.27 g/mol

Ref: 3D-YLB12545