CAS 92313-25-2

(4aR,6R,7R,7aS)-6-(6-amino-9H-purin-9-yl)-2-[(4,5-dimethoxy-2-nitrobenzyl)oxy]tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-7-ol 2-oxide

Description:

The chemical substance with the name "(4aR,6R,7R,7aS)-6-(6-amino-9H-purin-9-yl)-2-[(4,5-dimethoxy-2-nitrobenzyl)oxy]tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-7-ol 2-oxide" and CAS number "92313-25-2" is a complex organic compound characterized by its unique structural features, including a fused ring system and multiple functional groups. It contains a purine moiety, which is indicative of its potential biological activity, particularly in relation to nucleic acid interactions. The presence of a dioxaphosphinin ring suggests it may exhibit phosphorous-containing properties, which can be relevant in medicinal chemistry. Additionally, the dimethoxy and nitro substituents on the benzyl group may influence its solubility, reactivity, and overall pharmacological profile. This compound's stereochemistry, denoted by the specific configuration at multiple chiral centers, is crucial for its biological activity and interaction with target molecules. Overall, this substance may have applications in pharmaceuticals, particularly in the development of nucleoside analogs or other therapeutic agents.

Formula: C₁₉H₂₁N₆O₁₀P

InChI: InChI=1/C19H21N6O10P/c1-30-11-3-9(10(25(27)28)4-12(11)31-2)5-32-36(29)33-6-13-16(35-36)15(26)19(34-13)24-8-23-14-17(20)21-7-22-18(14)24/h3-4,7-8,13,15-16,19,26H,5-6H2,1-2H3,(H2,20,21,22)/t13-,15-,16-,19-,36?/m1/s1

SMILES: COc1cc(COP2(=O)OC[C@@H]3[C@H]([C@H]([C@H](n4cnc5c(N)ncnc45)O3)O)O2)c(cc1OC)N(=O)=O

DNMB-cAMP

Controlled Product

CAS: 92313-25-2

Formula: C₁₉H₂₁N₆O₁₀P

Color and Shape: Neat

Molecular weight: 524.378

Ref: TR-D568960