CAS 923139-07-5

(3-Fluoro-4-methylphenyl)-1-piperazinylmethanone

Description:

(3-Fluoro-4-methylphenyl)-1-piperazinylmethanone, identified by its CAS number 923139-07-5, is a chemical compound that features a piperazine ring, which is a six-membered heterocyclic structure containing two nitrogen atoms. This compound is characterized by the presence of a fluorine atom and a methyl group on a phenyl ring, contributing to its unique chemical properties. The piperazinylmethanone moiety suggests that it may exhibit biological activity, potentially interacting with various receptors or enzymes due to its structural features. The presence of the fluorine atom can enhance lipophilicity and metabolic stability, which are important factors in drug design. Additionally, the compound's molecular structure may influence its solubility, reactivity, and overall pharmacokinetic profile. While specific applications or biological activities may vary, compounds of this nature are often investigated in medicinal chemistry for their potential therapeutic effects. As with any chemical substance, safety data and handling precautions should be considered when working with this compound.

Formula: C₁₂H₁₅FN₂O

InChI: InChI=1S/C12H15FN2O/c1-9-2-3-10(8-11(9)13)12(16)15-6-4-14-5-7-15/h2-3,8,14H,4-7H2,1H3

InChI key: InChIKey=WSCWBOGWEMADSQ-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(F)=C(C)C=C1)N2CCNCC2

Synonyms:

• Methanone, (3-fluoro-4-methylphenyl)-1-piperazinyl-
• (3-Fluoro-4-methylphenyl)-1-piperazinylmethanone