CAS 923145-68-0
:2-amino-4-(difluoromethoxy)-5-methoxybenzoic acid
Description:
2-Amino-4-(difluoromethoxy)-5-methoxybenzoic acid is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety substituted with amino and methoxy groups. The presence of the difluoromethoxy group introduces significant polarity and can influence the compound's reactivity and solubility. This compound is likely to exhibit both acidic and basic properties due to the carboxylic acid and amino functional groups, respectively. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of drugs targeting specific biological pathways. The difluoromethoxy substituent may enhance the compound's bioactivity or selectivity. Additionally, the presence of multiple functional groups allows for various interactions with biological targets, making it a candidate for further research in medicinal chemistry. As with many organic compounds, its stability, solubility, and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 2-amino-4-(difluoromethoxy)-5-methoxybenzoic acid represents a complex structure with potential utility in various chemical and biological applications.
Formula:C9H9F2NO4
InChI:InChI=1/C9H9F2NO4/c1-15-6-2-4(8(13)14)5(12)3-7(6)16-9(10)11/h2-3,9H,12H2,1H3,(H,13,14)
SMILES:COc1cc(c(cc1OC(F)F)N)C(=O)O
Synonyms:- Benzoic Acid, 2-Amino-4-(Difluoromethoxy)-5-Methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
