CAS 92315-49-6

3-Methoxy-2,5-dimethylbenzoic acid

Description:

3-Methoxy-2,5-dimethylbenzoic acid is an aromatic carboxylic acid characterized by its methoxy and dimethyl substituents on a benzoic acid framework. The presence of the methoxy group at the 3-position and two methyl groups at the 2 and 5 positions contributes to its unique chemical properties, including its solubility and reactivity. This compound typically exhibits moderate polarity due to the carboxylic acid functional group, which can participate in hydrogen bonding, enhancing its solubility in polar solvents. The methyl groups can influence the compound's steric hindrance and electronic properties, potentially affecting its reactivity in various chemical reactions. Additionally, 3-Methoxy-2,5-dimethylbenzoic acid may exhibit biological activity, making it of interest in pharmaceutical and agrochemical research. Its CAS number, 92315-49-6, allows for easy identification and retrieval of information in chemical databases. Overall, this compound is notable for its structural features that can impact its physical and chemical behavior in different environments.

Formula: C₁₀H₁₂O₃

InChI: InChI=1S/C10H12O3/c1-6-4-8(10(11)12)7(2)9(5-6)13-3/h4-5H,1-3H3,(H,11,12)

InChI key: InChIKey=SUSSFYUYIFADRR-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(C)C(OC)=CC(C)=C1

Synonyms:

• 3-Methoxy-2,5-dimethylbenzoic acid
• Benzoic acid, 3-methoxy-2,5-dimethyl-
• m-Anisic acid, 2,5-dimethyl-