CAS 923156-09-6
:N-Cyclohexyl-N-methyl-1-piperazinesulfonamide
Description:
N-Cyclohexyl-N-methyl-1-piperazinesulfonamide is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. This compound features a cyclohexyl group and a methyl group attached to the nitrogen atoms of the piperazine, along with a sulfonamide functional group. The presence of the sulfonamide group contributes to its potential biological activity, as sulfonamides are known for their antibacterial properties. The compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the sulfonamide group. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. Additionally, the cyclohexyl and methyl substituents can influence the compound's lipophilicity and pharmacokinetic properties, making it a subject of interest in drug design and development. As with many chemical substances, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C11H23N3O2S
InChI:InChI=1S/C11H23N3O2S/c1-13(11-5-3-2-4-6-11)17(15,16)14-9-7-12-8-10-14/h11-12H,2-10H2,1H3
InChI key:InChIKey=YFYZPRKKMXYLHL-UHFFFAOYSA-N
SMILES:N(S(=O)(=O)N1CCNCC1)(C)C2CCCCC2
Synonyms:- 1-Piperazinesulfonamide, N-cyclohexyl-N-methyl-
- N-Cyclohexyl-N-methyl-1-piperazinesulfonamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.