CymitQuimica logo

CAS 923156-14-3

:

4-(2-Chloroacetyl)-3,4-dihydro-2H-1,4-benzoxazine-2-carboxamide

Description:
4-(2-Chloroacetyl)-3,4-dihydro-2H-1,4-benzoxazine-2-carboxamide is a chemical compound characterized by its unique structural features, which include a benzoxazine ring and a chloroacetyl group. This compound typically exhibits properties associated with both amides and heterocyclic compounds, making it of interest in various fields, including medicinal chemistry and materials science. The presence of the chloroacetyl moiety suggests potential reactivity, particularly in nucleophilic substitution reactions. The benzoxazine structure contributes to its stability and may influence its solubility and interaction with biological systems. Additionally, compounds of this type may exhibit biological activity, which can be explored for therapeutic applications. Its molecular weight, solubility in various solvents, and specific reactivity profiles would depend on the precise conditions and environment in which it is studied. Overall, this compound represents a class of organic molecules that can be tailored for specific applications through modifications of its functional groups.
Formula:C11H11ClN2O3
InChI:InChI=1S/C11H11ClN2O3/c12-5-10(15)14-6-9(11(13)16)17-8-4-2-1-3-7(8)14/h1-4,9H,5-6H2,(H2,13,16)
InChI key:InChIKey=ARXMOGIPJRHYNG-UHFFFAOYSA-N
SMILES:C(CCl)(=O)N1C=2C(OC(C(N)=O)C1)=CC=CC2
Synonyms:
  • 2H-1,4-Benzoxazine-2-carboxamide, 4-(2-chloroacetyl)-3,4-dihydro-
  • 4-(2-Chloroacetyl)-3,4-dihydro-2H-1,4-benzoxazine-2-carboxamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.