CAS 92316-06-8

2-[(3-nitropyridin-2-yl)sulfanyl]aniline

Description:

2-[(3-Nitropyridin-2-yl)sulfanyl]aniline is an organic compound characterized by the presence of both an aniline and a pyridine moiety, linked through a sulfur atom. The compound features a nitro group (-NO2) attached to the pyridine ring, which contributes to its electronic properties and potential reactivity. The sulfur atom introduces a thioether functional group, enhancing the compound's nucleophilicity and potential for further chemical modifications. This compound may exhibit interesting biological activities due to its structural components, making it a candidate for research in medicinal chemistry. Its molecular structure suggests potential applications in the development of pharmaceuticals or agrochemicals. The presence of the nitro group can also influence the compound's solubility and stability in various solvents. Overall, 2-[(3-nitropyridin-2-yl)sulfanyl]aniline is a versatile compound with unique characteristics that may be explored in various chemical and biological contexts.

Formula: C₁₁H₉N₃O₂S

InChI: InChI=1/C11H9N3O2S/c12-8-4-1-2-6-10(8)17-11-9(14(15)16)5-3-7-13-11/h1-7H,12H2

SMILES: c1ccc(c(c1)N)Sc1c(cccn1)N(=O)=O

2-[(3-nitro-2-pyridinyl)sulfanyl]aniline

CAS: 92316-06-8

2-[(3-nitro-2-pyridinyl)sulfanyl]aniline

Purity: 95%

Molecular weight: 247.28g/mol

Ref: 54-OR1004261