CymitQuimica logo

CAS 92316-76-2

:

N-(3-Cyanophenyl)glycine ethyl ester

Description:
N-(3-Cyanophenyl)glycine ethyl ester is an organic compound characterized by its structure, which includes a glycine moiety linked to a 3-cyanophenyl group and an ethyl ester functional group. This compound typically exhibits properties associated with both amino acids and esters, such as being polar and capable of forming hydrogen bonds due to the presence of the amino and carboxylate functionalities. The cyanophenyl group contributes to its potential for various chemical reactivities, including nucleophilic substitutions and electrophilic additions. Additionally, the ethyl ester group enhances its lipophilicity, which may influence its solubility in organic solvents. This compound may be of interest in pharmaceutical research and organic synthesis, particularly in the development of biologically active molecules. Its specific applications and behavior in reactions would depend on the context of its use, including potential interactions with biological systems or other chemical entities. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C11H12N2O2
InChI:InChI=1S/C11H12N2O2/c1-2-15-11(14)8-13-10-5-3-4-9(6-10)7-12/h3-6,13H,2,8H2,1H3
InChI key:InChIKey=QHVWNEPCWNCEJF-UHFFFAOYSA-N
SMILES:N(CC(OCC)=O)C1=CC(C#N)=CC=C1
Synonyms:
  • Glycine, N-(3-cyanophenyl)-, ethyl ester
  • N-(3-Cyanophenyl)glycine ethyl ester
  • Glycine, N-(m-cyanophenyl)-, ethyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.