CAS 923163-47-7

(2-Aminophenyl)(3-methyl-1-piperidinyl)methanone

Description:

(2-Aminophenyl)(3-methyl-1-piperidinyl)methanone, identified by its CAS number 923163-47-7, is a chemical compound that features a phenyl ring substituted with an amino group and a piperidine moiety. This compound typically exhibits characteristics common to amides and amines, such as potential basicity due to the presence of the amino group and the piperidine nitrogen. The structure suggests it may engage in hydrogen bonding, influencing its solubility and reactivity. It is likely to be a solid at room temperature, with potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, given its structural features that may interact with biological targets. The presence of the piperidine ring may also contribute to its pharmacological properties, such as modulating neurotransmitter systems. As with many organic compounds, its stability, reactivity, and biological activity would depend on various factors, including environmental conditions and the presence of other chemical species.

Formula: C₁₃H₁₈N₂O

InChI: InChI=1S/C13H18N2O/c1-10-5-4-8-15(9-10)13(16)11-6-2-3-7-12(11)14/h2-3,6-7,10H,4-5,8-9,14H2,1H3

InChI key: InChIKey=PXFWRLYTTJEUOI-UHFFFAOYSA-N

SMILES: C(=O)(N1CC(C)CCC1)C2=C(N)C=CC=C2

Synonyms:

• (2-Aminophenyl)(3-methyl-1-piperidinyl)methanone
• Methanone, (2-aminophenyl)(3-methyl-1-piperidinyl)-