CAS 923170-54-1

5-Chloro-2-methoxy-α-(trifluoromethyl)benzenemethanol

Description:

5-Chloro-2-methoxy-α-(trifluoromethyl)benzenemethanol is an organic compound characterized by its complex structure, which includes a chloro group, a methoxy group, and a trifluoromethyl group attached to a benzene ring. The presence of these functional groups contributes to its unique chemical properties, such as increased lipophilicity and potential reactivity in various chemical reactions. The trifluoromethyl group is known for enhancing the compound's metabolic stability and altering its electronic properties, which can influence its biological activity. The hydroxymethyl group provides the compound with potential for hydrogen bonding, affecting solubility and interaction with other molecules. This compound may be of interest in pharmaceutical research and development due to its structural features, which could lead to specific biological activities. Additionally, its synthesis and characterization would involve standard organic chemistry techniques, including nucleophilic substitution and functional group transformations. Overall, 5-Chloro-2-methoxy-α-(trifluoromethyl)benzenemethanol represents a versatile building block in organic synthesis and medicinal chemistry.

Formula: C₉H₈ClF₃O₂

InChI: InChI=1S/C9H8ClF3O2/c1-15-7-3-2-5(10)4-6(7)8(14)9(11,12)13/h2-4,8,14H,1H3

InChI key: InChIKey=HIXYZNAEMJPIPE-UHFFFAOYSA-N

SMILES: C(C(F)(F)F)(O)C1=C(OC)C=CC(Cl)=C1

Synonyms:

• 5-Chloro-2-methoxy-α-(trifluoromethyl)benzenemethanol
• Benzenemethanol, 5-chloro-2-methoxy-α-(trifluoromethyl)-