
CAS 923215-72-9
:3-(3,5-Dimethyl-4-isoxazolyl)-1-(1-piperazinyl)-1-propanone
Description:
3-(3,5-Dimethyl-4-isoxazolyl)-1-(1-piperazinyl)-1-propanone, with the CAS number 923215-72-9, is a chemical compound characterized by its unique structural features, which include an isoxazole ring and a piperazine moiety. The isoxazole ring contributes to its potential biological activity, often associated with neuroactive properties. The presence of the piperazine group suggests possible interactions with neurotransmitter receptors, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting central nervous system disorders. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on its specific functional groups. Its molecular structure allows for various chemical reactions, which can be exploited in synthetic pathways for further derivatization. As with many compounds in this class, understanding its pharmacokinetics and pharmacodynamics is crucial for assessing its therapeutic potential and safety profile.
Formula:C12H19N3O2
InChI:InChI=1S/C12H19N3O2/c1-9-11(10(2)17-14-9)3-4-12(16)15-7-5-13-6-8-15/h13H,3-8H2,1-2H3
InChI key:InChIKey=NIMHGHQOIMIEQS-UHFFFAOYSA-N
SMILES:C(CC(=O)N1CCNCC1)C=2C(C)=NOC2C
Synonyms:- 1-Propanone, 3-(3,5-dimethyl-4-isoxazolyl)-1-(1-piperazinyl)-
- 3-(3,5-Dimethyl-4-isoxazolyl)-1-(1-piperazinyl)-1-propanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.