CymitQuimica logo

CAS 92322-05-9

:

(1-phenethyl-3-piperidyl)methanol

Description:
(1-phenethyl-3-piperidyl)methanol, with the CAS number 92322-05-9, is a chemical compound characterized by its unique structure, which includes a piperidine ring and a phenethyl group. This compound typically exhibits properties associated with both amines and alcohols due to the presence of the piperidine nitrogen and the hydroxymethyl group. It is likely to be a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. The compound may have moderate solubility in polar solvents like water and alcohols, while being less soluble in non-polar solvents. Its molecular structure suggests potential biological activity, which may include interactions with neurotransmitter systems, making it of interest in pharmacological research. Additionally, the presence of the hydroxymethyl group may impart reactivity, allowing for further chemical modifications. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C14H21NO
InChI:InChI=1/C14H21NO/c16-12-14-7-4-9-15(11-14)10-8-13-5-2-1-3-6-13/h1-3,5-6,14,16H,4,7-12H2
SMILES:c1ccc(cc1)CCN1CCCC(C1)CO
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.