CAS 923225-79-0

1-[(3-Fluorophenyl)methyl]-1,4,5,6-tetrahydro-6-oxo-3-pyridazinecarboxylic acid

Description:

1-[(3-Fluorophenyl)methyl]-1,4,5,6-tetrahydro-6-oxo-3-pyridazinecarboxylic acid is a chemical compound characterized by its unique structure, which includes a pyridazine ring fused with a carboxylic acid functional group. The presence of a fluorophenyl group enhances its potential for biological activity, possibly influencing its pharmacological properties. This compound is likely to exhibit moderate solubility in polar solvents due to the carboxylic acid moiety, while the fluorine atom may impart lipophilicity, affecting its interaction with biological membranes. The tetrahydro structure suggests that it may exist in a stable conformation, which could be relevant for its reactivity and binding to biological targets. Additionally, the compound may exhibit specific stereochemistry, which can influence its biological activity and interactions. Overall, this compound's characteristics make it a subject of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting various diseases. Further studies would be necessary to elucidate its specific properties and potential applications.

Formula: C₁₂H₁₁FN₂O₃

InChI: InChI=1S/C12H11FN2O3/c13-9-3-1-2-8(6-9)7-15-11(16)5-4-10(14-15)12(17)18/h1-3,6H,4-5,7H2,(H,17,18)

InChI key: InChIKey=ZGGQPUURDCTZSX-UHFFFAOYSA-N

SMILES: C(N1N=C(C(O)=O)CCC1=O)C2=CC(F)=CC=C2

Synonyms:

• 1-[(3-Fluorophenyl)methyl]-1,4,5,6-tetrahydro-6-oxo-3-pyridazinecarboxylic acid
• 3-Pyridazinecarboxylic acid, 1-[(3-fluorophenyl)methyl]-1,4,5,6-tetrahydro-6-oxo-