CymitQuimica logo

CAS 92326-91-5

:

2-methyl-2-(4-phenylpiperazin-1-yl)propanenitrile

Description:
2-Methyl-2-(4-phenylpiperazin-1-yl)propanenitrile, identified by its CAS number 92326-91-5, is a chemical compound characterized by its unique structure, which includes a nitrile functional group and a piperazine moiety. This compound typically exhibits a moderate to high polarity due to the presence of the nitrile group, which can influence its solubility in various solvents. The piperazine ring contributes to its potential biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting neurological conditions. The presence of the phenyl group enhances its lipophilicity, which may affect its pharmacokinetic properties. Additionally, the compound's synthesis involves standard organic reactions, and it may be characterized using techniques such as NMR spectroscopy, mass spectrometry, and infrared spectroscopy to confirm its structure and purity. Overall, 2-methyl-2-(4-phenylpiperazin-1-yl)propanenitrile represents a compound with potential applications in drug development, particularly in areas related to central nervous system activity.
Formula:C14H19N3
InChI:InChI=1/C14H19N3/c1-14(2,12-15)17-10-8-16(9-11-17)13-6-4-3-5-7-13/h3-7H,8-11H2,1-2H3
InChI key:XDVABEIORUOHPE-UHFFFAOYSA-N
SMILES:CC(C)(C#N)N1CCN(CC1)c1ccccc1
Found 1 products.