CAS 923282-39-7

7-Chloro-1-methyl-1H-pyrazolo[4,3-d]pyrimidine

Description:

7-Chloro-1-methyl-1H-pyrazolo[4,3-d]pyrimidine is a heterocyclic compound characterized by its unique pyrazolo-pyrimidine structure, which incorporates both pyrazole and pyrimidine rings. This compound typically exhibits a molecular formula that reflects its complex structure, featuring chlorine and methyl substituents that influence its chemical reactivity and biological activity. It is often studied for its potential pharmacological properties, particularly in the context of medicinal chemistry, where it may serve as a scaffold for developing new therapeutic agents. The presence of the chlorine atom can enhance lipophilicity and affect the compound's interaction with biological targets. Additionally, the methyl group at the 1-position contributes to the overall stability and solubility of the molecule. As with many heterocycles, 7-Chloro-1-methyl-1H-pyrazolo[4,3-d]pyrimidine may exhibit interesting electronic properties, making it a subject of interest in both synthetic and applied chemistry. Its CAS number, 923282-39-7, allows for easy identification and reference in chemical databases and literature.

Formula: C₆H₅ClN₄

InChI: InChI=1/C6H5ClN4/c1-11-5-4(2-10-11)8-3-9-6(5)7/h2-3H,1H3

SMILES: Cn1c2c(cn1)ncnc2Cl

Synonyms:

• 1H-pyrazolo[4,3-d]pyrimidine, 7-chloro-1-methyl-

7-Chloro-1-methyl-1H-pyrazolo[4,3-d]pyrimidine

CAS: 923282-39-7

Formula: C₆H₅ClN₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 168.5837

Ref: IN-DA0038JE

7-Chloro-1-methyl-1H-pyrazolo[4,3-d]pyrimidine

CAS: 923282-39-7

7-Chloro-1-methyl-1H-pyrazolo[4,3-d]pyrimidine

Purity: 98%

Molecular weight: 168.58g/mol

Ref: 54-OR83843

7-Chloro-1-methyl-1H-pyrazolo[4,3-d]pyrimidine

CAS: 923282-39-7

Formula: C₆H₅ClN₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 168.58

Ref: 10-F093635