CymitQuimica logo

CAS 923282-41-1

:

7-Chloro-2-methyl-2H-pyrazolo[4,3-d]pyrimidine

Description:
7-Chloro-2-methyl-2H-pyrazolo[4,3-d]pyrimidine is a heterocyclic compound characterized by its pyrazolo-pyrimidine structure, which incorporates both pyrazole and pyrimidine rings. This compound features a chlorine atom at the 7-position and a methyl group at the 2-position of the pyrazolo ring, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the chlorine atom can influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. This compound is of interest in medicinal chemistry due to its potential biological activities, which may include anti-inflammatory or anticancer properties. Its molecular structure allows for interactions with biological targets, making it a subject of research in drug development. As with many heterocycles, the stability and reactivity of 7-Chloro-2-methyl-2H-pyrazolo[4,3-d]pyrimidine can be influenced by the presence of functional groups and the overall electronic environment of the molecule.
Formula:C6H5ClN4
InChI:InChI=1S/C6H5ClN4/c1-11-2-4-5(10-11)6(7)9-3-8-4/h2-3H,1H3
InChI key:InChIKey=ZXVUORXEWWBPEP-UHFFFAOYSA-N
SMILES:ClC=1C=2C(=CN(C)N2)N=CN1
Synonyms:
  • 2H-Pyrazolo[4,3-d]pyrimidine, 7-chloro-2-methyl-
  • 7-Chloro-2-methyl-2H-pyrazolo[4,3-d]pyrimidine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.