CAS 92332-17-7
:Boric acid (H3BO3), reaction products with by-products from manuf. of 2-butoxyethanol
Description:
Boric acid (H3BO3) is a weak acid that exhibits unique characteristics, including its role as a mild antiseptic, insecticide, and pH buffer. It is a colorless, odorless solid that is soluble in water, forming a slightly acidic solution. In the context of its reaction products with by-products from the manufacture of 2-butoxyethanol, boric acid can interact with various organic compounds, potentially leading to the formation of esters or borate esters, depending on the specific reactants involved. The by-products from 2-butoxyethanol production may include various alcohols and ethers, which can influence the reactivity and stability of the resulting compounds. The presence of boron in boric acid can enhance the thermal stability and modify the physical properties of the reaction products. Overall, the interactions between boric acid and by-products from 2-butoxyethanol synthesis can yield a range of chemical species with diverse applications in industrial and agricultural settings.
Formula:C6H14O2·BH3O3
InChI:InChI=1S/C6H14O2.BH3O3/c1-2-3-5-8-6-4-7;2-1(3)4/h7H,2-6H2,1H3;2-4H
InChI key:InChIKey=HVELLBJQJZKDOS-UHFFFAOYSA-N
SMILES:B(O)(O)O.C(OCCO)CCC
Synonyms:- Boric acid (H3BO3), reaction products with by-products from manuf. of 2-butoxyethanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Boric acid (H3BO3), reaction products with by-products from manuf. of 2-butoxyethanol
CAS:Formula:C6H17BO5Molecular weight:180.0072
