CymitQuimica logo

CAS 92341-04-3

:

1,3,4,8-tetrachlorodibenzo[b,d]furan

Description:
1,3,4,8-Tetrachlorodibenzo[b,d]furan is a synthetic organic compound characterized by its complex polycyclic structure, which consists of two fused benzene rings and a furan ring, with four chlorine atoms substituted at specific positions. This compound is part of a larger class of chlorinated dibenzofurans, which are known for their environmental persistence and potential toxicity. It typically appears as a solid at room temperature and is insoluble in water but may dissolve in organic solvents. The presence of chlorine atoms significantly influences its chemical properties, including its reactivity and stability. 1,3,4,8-Tetrachlorodibenzo[b,d]furan is of interest in environmental chemistry due to its formation as a byproduct in various industrial processes, particularly in the production of chlorinated compounds. Its potential effects on human health and ecosystems are subjects of ongoing research, as chlorinated dibenzofurans can exhibit carcinogenic and endocrine-disrupting properties. Proper handling and disposal are essential to mitigate environmental and health risks associated with this compound.
Formula:C12H4Cl4O
InChI:InChI=1/C12H4Cl4O/c13-5-1-2-9-6(3-5)10-7(14)4-8(15)11(16)12(10)17-9/h1-4H
SMILES:c1cc2c(cc1Cl)c1c(cc(c(c1o2)Cl)Cl)Cl
Synonyms:
  • 1,3,4,8-Tetrachlorodibenzofuran
  • Dibenzofuran, 1,3,4,8-tetrachloro
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.