CAS 92341-07-6
:1,2,3,4,8,9-hexachlorodibenzo[b,d]furan
Description:
1,2,3,4,8,9-Hexachlorodibenzo[b,d]furan (CAS 92341-07-6) is a chlorinated aromatic compound belonging to the class of dibenzofurans, which are polycyclic aromatic compounds. This substance is characterized by the presence of six chlorine atoms substituted on the dibenzofuran structure, which significantly influences its chemical properties and environmental behavior. It is typically a white to yellow solid with low solubility in water but higher solubility in organic solvents. The compound is known for its persistence in the environment, potential bioaccumulation in living organisms, and toxicity, which raises concerns regarding its impact on human health and ecosystems. Hexachlorodibenzo[b,d]furan is often studied in the context of environmental pollution, particularly in relation to industrial processes that may release such chlorinated compounds. Its stability and resistance to degradation make it a subject of regulatory scrutiny and environmental monitoring efforts.
Formula:C12H2Cl6O
InChI:InChI=1/C12H2Cl6O/c13-3-1-2-4-5(7(3)14)6-8(15)9(16)10(17)11(18)12(6)19-4/h1-2H
SMILES:c1cc2c(c3c(c(c(c(c3o2)Cl)Cl)Cl)Cl)c(c1Cl)Cl
Synonyms:- 1,2,3,4,8,9-Hexachlorodibenzofuran
- Dibenzofuran, 1,2,3,4,8,9-hexachloro
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.