CAS 92352-25-5
:5-(2-Thienyl)-1H-pyrazole-3-carboxylic acid hydrazide
Description:
5-(2-Thienyl)-1H-pyrazole-3-carboxylic acid hydrazide is a chemical compound characterized by its unique structure, which includes a thienyl group and a pyrazole moiety. This compound typically exhibits properties associated with both heterocyclic compounds and hydrazides, such as potential biological activity and reactivity due to the presence of functional groups. It may display moderate solubility in polar solvents, influenced by its carboxylic acid and hydrazide functionalities. The thienyl group can contribute to its electronic properties, potentially enhancing its reactivity or interaction with biological targets. This compound is of interest in medicinal chemistry and may be explored for applications in pharmaceuticals, particularly in the development of new therapeutic agents. Its synthesis and characterization would involve standard organic chemistry techniques, and it may be subject to various analytical methods for purity and structural confirmation. As with many such compounds, safety data and handling precautions should be considered due to potential toxicity or reactivity.
Formula:C8H8N4OS
InChI:InChI=1S/C8H8N4OS/c9-10-8(13)6-4-5(11-12-6)7-2-1-3-14-7/h1-4H,9H2,(H,10,13)(H,11,12)
InChI key:InChIKey=JHJCTDRHIVSVRT-UHFFFAOYSA-N
SMILES:C(NN)(=O)C=1C=C(NN1)C2=CC=CS2
Synonyms:- 1H-Pyrazole-3-carboxylic acid, 5-(2-thienyl)-, hydrazide
- 5-(2-Thienyl)-1H-pyrazole-3-carboxylic acid hydrazide
- Pyrazole-3(or 5)-carboxylic acid, 5(or 3)-(2-thienyl)-, hydrazide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
